C20H15ClFN3OS — CID 135693220
4-[5-anilino-3-(4-fluorophenyl)-1,3,4-thiadiazol-3-ium-2-yl]phenol chloride (PubChem CID 135693220) has the molecular formula C20H15ClFN3OS and a molecular weight of 399.88 g/mol. Its IUPAC name is 4-[5-anilino-3-(4-fluorophenyl)-1,3,4-thiadiazol-3-ium-2-yl]phenol chloride.
| Compound Name | 4-[5-anilino-3-(4-fluorophenyl)-1,3,4-thiadiazol-3-ium-2-yl]phenol chloride |
|---|---|
| PubChem CID | 135693220 |
| Molecular Formula | C20H15ClFN3OS |
| Molecular Weight | 399.88 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | 4-[5-anilino-3-(4-fluorophenyl)-1,3,4-thiadiazol-3-ium-2-yl]phenol chloride |
| SMILES | Oc1ccc(-c2sc(Nc3ccccc3)n[n+]2-c2ccc(F)cc2)cc1.[Cl-] |
| InChI | InChI=1S/C20H14FN3OS.ClH/c21-15-8-10-17(11-9-15)24-19(14-6-12-18(25)13-7-14)26-20(23-24)22-16-4-2-1-3-5-16;/h1-13H,(H,22,23);1H |
| InChIKey | WPNWORXINYUAGQ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 49.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.88 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|