C15H13FN4S — CID 11289585
5-[(4-fluoroanilino)methyl]-N-phenyl-1,3,4-thiadiazol-2-amine (PubChem CID 11289585) has the molecular formula C15H13FN4S and a molecular weight of 300.36 g/mol. Its IUPAC name is 5-[(4-fluoroanilino)methyl]-N-phenyl-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[(4-fluoroanilino)methyl]-N-phenyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 11289585 |
| Molecular Formula | C15H13FN4S |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 5-[(4-fluoroanilino)methyl]-N-phenyl-1,3,4-thiadiazol-2-amine |
| SMILES | Fc1ccc(NCc2nnc(Nc3ccccc3)s2)cc1 |
| InChI | InChI=1S/C15H13FN4S/c16-11-6-8-12(9-7-11)17-10-14-19-20-15(21-14)18-13-4-2-1-3-5-13/h1-9,17H,10H2,(H,18,20) |
| InChIKey | XHANGKBWNHRVPD-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |