C15H22N3O3PS — CID 139600034
5-[di(propan-2-yloxy)phosphorylmethyl]-N-phenyl-1,3,4-thiadiazol-2-amine (PubChem CID 139600034) has the molecular formula C15H22N3O3PS and a molecular weight of 355.40 g/mol. Its IUPAC name is 5-[di(propan-2-yloxy)phosphorylmethyl]-N-phenyl-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[di(propan-2-yloxy)phosphorylmethyl]-N-phenyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 139600034 |
| Molecular Formula | C15H22N3O3PS |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 5-[di(propan-2-yloxy)phosphorylmethyl]-N-phenyl-1,3,4-thiadiazol-2-amine |
| SMILES | CC(C)OP(=O)(Cc1nnc(Nc2ccccc2)s1)OC(C)C |
| InChI | InChI=1S/C15H22N3O3PS/c1-11(2)20-22(19,21-12(3)4)10-14-17-18-15(23-14)16-13-8-6-5-7-9-13/h5-9,11-12H,10H2,1-4H3,(H,16,18) |
| InChIKey | RCCRWZAVQNNZHU-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|