C20H23N4O4PS — CID 39868584
N-[(S)-(5-anilino-1,3,4-thiadiazol-2-yl)-diethoxyphosphorylmethyl]benzamide (PubChem CID 39868584) has the molecular formula C20H23N4O4PS and a molecular weight of 446.47 g/mol. Its IUPAC name is N-[(S)-(5-anilino-1,3,4-thiadiazol-2-yl)-diethoxyphosphorylmethyl]benzamide.
| Compound Name | N-[(S)-(5-anilino-1,3,4-thiadiazol-2-yl)-diethoxyphosphorylmethyl]benzamide |
|---|---|
| PubChem CID | 39868584 |
| Molecular Formula | C20H23N4O4PS |
| Molecular Weight | 446.47 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | N-[(S)-(5-anilino-1,3,4-thiadiazol-2-yl)-diethoxyphosphorylmethyl]benzamide |
| SMILES | CCOP(=O)(OCC)[C@H](NC(=O)c1ccccc1)c1nnc(Nc2ccccc2)s1 |
| InChI | InChI=1S/C20H23N4O4PS/c1-3-27-29(26,28-4-2)18(22-17(25)15-11-7-5-8-12-15)19-23-24-20(30-19)21-16-13-9-6-10-14-16/h5-14,18H,3-4H2,1-2H3,(H,21,24)(H,22,25)/t18-/m0/s1 |
| InChIKey | NYOYVDANIBJAAE-SFHVURJKSA-N |
| XLogP | 4.98 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.47 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|