C16H10Cl2FN3 — CID 86045434
4,6-dichloro-5-(4-fluorophenyl)-N-phenylpyrimidin-2-amine (PubChem CID 86045434) has the molecular formula C16H10Cl2FN3 and a molecular weight of 334.18 g/mol. Its IUPAC name is 4,6-dichloro-5-(4-fluorophenyl)-N-phenylpyrimidin-2-amine.
| Compound Name | 4,6-dichloro-5-(4-fluorophenyl)-N-phenylpyrimidin-2-amine |
|---|---|
| PubChem CID | 86045434 |
| Molecular Formula | C16H10Cl2FN3 |
| Molecular Weight | 334.18 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | 4,6-dichloro-5-(4-fluorophenyl)-N-phenylpyrimidin-2-amine |
| SMILES | Fc1ccc(-c2c(Cl)nc(Nc3ccccc3)nc2Cl)cc1 |
| InChI | InChI=1S/C16H10Cl2FN3/c17-14-13(10-6-8-11(19)9-7-10)15(18)22-16(21-14)20-12-4-2-1-3-5-12/h1-9H,(H,20,21,22) |
| InChIKey | GXZMEIMZCMMJLD-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.18 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |