C17H13Cl2N3 — CID 86045532
4,6-dichloro-5-(2-methylphenyl)-N-phenylpyrimidin-2-amine (PubChem CID 86045532) has the molecular formula C17H13Cl2N3 and a molecular weight of 330.22 g/mol. Its IUPAC name is 4,6-dichloro-5-(2-methylphenyl)-N-phenylpyrimidin-2-amine.
| Compound Name | 4,6-dichloro-5-(2-methylphenyl)-N-phenylpyrimidin-2-amine |
|---|---|
| PubChem CID | 86045532 |
| Molecular Formula | C17H13Cl2N3 |
| Molecular Weight | 330.22 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | 4,6-dichloro-5-(2-methylphenyl)-N-phenylpyrimidin-2-amine |
| SMILES | Cc1ccccc1-c1c(Cl)nc(Nc2ccccc2)nc1Cl |
| InChI | InChI=1S/C17H13Cl2N3/c1-11-7-5-6-10-13(11)14-15(18)21-17(22-16(14)19)20-12-8-3-2-4-9-12/h2-10H,1H3,(H,20,21,22) |
| InChIKey | DYADXTLXHHQMFM-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.22 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |