C31H22Cl2FN9 — CID 11714205
4-N-[4-[2-amino-6-(2,4-dichlorophenyl)pyrimidin-4-yl]phenyl]-2-N-(4-fluorophenyl)-6-N-phenyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 11714205) has the molecular formula C31H22Cl2FN9 and a molecular weight of 610.48 g/mol. Its IUPAC name is 4-N-[4-[2-amino-6-(2,4-dichlorophenyl)pyrimidin-4-yl]phenyl]-2-N-(4-fluorophenyl)-6-N-phenyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-[4-[2-amino-6-(2,4-dichlorophenyl)pyrimidin-4-yl]phenyl]-2-N-(4-fluorophenyl)-6-N-phenyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 11714205 |
| Molecular Formula | C31H22Cl2FN9 |
| Molecular Weight | 610.48 g/mol |
| Exact Mass | 609.14 |
| IUPAC Name | 4-N-[4-[2-amino-6-(2,4-dichlorophenyl)pyrimidin-4-yl]phenyl]-2-N-(4-fluorophenyl)-6-N-phenyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | Nc1nc(-c2ccc(Nc3nc(Nc4ccccc4)nc(Nc4ccc(F)cc4)n3)cc2)cc(-c2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C31H22Cl2FN9/c32-19-8-15-24(25(33)16-19)27-17-26(39-28(35)40-27)18-6-11-22(12-7-18)37-30-41-29(36-21-4-2-1-3-5-21)42-31(43-30)38-23-13-9-20(34)10-14-23/h1-17H,(H2,35,39,40)(H3,36,37,38,41,42,43) |
| InChIKey | LWCXAHPOWYBMKW-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.48 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |