C75H54N6 — CID 146533849
2-N,4-N,6-N-tris[4-[4-(4-phenylphenyl)phenyl]phenyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 146533849) has the molecular formula C75H54N6 and a molecular weight of 1039.30 g/mol. Its IUPAC name is 2-N,4-N,6-N-tris[4-[4-(4-phenylphenyl)phenyl]phenyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,4-N,6-N-tris[4-[4-(4-phenylphenyl)phenyl]phenyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 146533849 |
| Molecular Formula | C75H54N6 |
| Molecular Weight | 1039.30 g/mol |
| Exact Mass | 1038.44 |
| IUPAC Name | 2-N,4-N,6-N-tris[4-[4-(4-phenylphenyl)phenyl]phenyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | c1ccc(-c2ccc(-c3ccc(-c4ccc(Nc5nc(Nc6ccc(-c7ccc(-c8ccc(-c9ccccc9)cc8)cc7)cc6)nc(Nc6ccc(-c7ccc(-c8ccc(-c9ccccc9)cc8)cc7)cc6)n5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C75H54N6/c1-4-10-52(11-5-1)55-16-22-58(23-17-55)61-28-34-64(35-29-61)67-40-46-70(47-41-67)76-73-79-74(77-71-48-42-68(43-49-71)65-36-30-62(31-37-65)59-24-18-56(19-25-59)53-12-6-2-7-13-53)81-75(80-73)78-72-50-44-69(45-51-72)66-38-32-63(33-39-66)60-26-20-57(21-27-60)54-14-8-3-9-15-54/h1-51H,(H3,76,77,78,79,80,81) |
| InChIKey | SIRIYWUEDSIFAT-UHFFFAOYSA-N |
| XLogP | 20.11 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 81 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1039.30 |
| LogP ≤ 5 | 20.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |