C18H16Br2N2S — CID 45125415
N-(3-bromophenyl)-4-phenyl-3-prop-2-enyl-1,3-thiazol-3-ium-2-amine bromide (PubChem CID 45125415) has the molecular formula C18H16Br2N2S and a molecular weight of 452.22 g/mol. Its IUPAC name is N-(3-bromophenyl)-4-phenyl-3-prop-2-enyl-1,3-thiazol-3-ium-2-amine bromide.
| Compound Name | N-(3-bromophenyl)-4-phenyl-3-prop-2-enyl-1,3-thiazol-3-ium-2-amine bromide |
|---|---|
| PubChem CID | 45125415 |
| Molecular Formula | C18H16Br2N2S |
| Molecular Weight | 452.22 g/mol |
| Exact Mass | 449.94 |
| IUPAC Name | N-(3-bromophenyl)-4-phenyl-3-prop-2-enyl-1,3-thiazol-3-ium-2-amine bromide |
| SMILES | C=CC[n+]1c(-c2ccccc2)csc1Nc1cccc(Br)c1.[Br-] |
| InChI | InChI=1S/C18H15BrN2S.BrH/c1-2-11-21-17(14-7-4-3-5-8-14)13-22-18(21)20-16-10-6-9-15(19)12-16;/h2-10,12-13H,1,11H2;1H |
| InChIKey | JABVCPJCMKEOTB-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 15.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.22 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiaz_ene_D(8)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|