C22H17Cl3N2S — CID 45125417
4-(2,4-dichlorophenyl)-N-naphthalen-1-yl-3-prop-2-enyl-1,3-thiazol-3-ium-2-amine chloride (PubChem CID 45125417) has the molecular formula C22H17Cl3N2S and a molecular weight of 447.82 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-N-naphthalen-1-yl-3-prop-2-enyl-1,3-thiazol-3-ium-2-amine chloride.
| Compound Name | 4-(2,4-dichlorophenyl)-N-naphthalen-1-yl-3-prop-2-enyl-1,3-thiazol-3-ium-2-amine chloride |
|---|---|
| PubChem CID | 45125417 |
| Molecular Formula | C22H17Cl3N2S |
| Molecular Weight | 447.82 g/mol |
| Exact Mass | 446.02 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-N-naphthalen-1-yl-3-prop-2-enyl-1,3-thiazol-3-ium-2-amine chloride |
| SMILES | C=CC[n+]1c(-c2ccc(Cl)cc2Cl)csc1Nc1cccc2ccccc12.[Cl-] |
| InChI | InChI=1S/C22H16Cl2N2S.ClH/c1-2-12-26-21(18-11-10-16(23)13-19(18)24)14-27-22(26)25-20-9-5-7-15-6-3-4-8-17(15)20;/h2-11,13-14H,1,12H2;1H |
| InChIKey | OBYZIRMFZBXYMU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 15.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.82 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiaz_ene_D(8)', 'substructure': 'N/A'}, {'alert_name': 'thiazole_amine_D(3)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|