C20H18Cl2N3OS+ — CID 3340964
N-[4-[[4-(2,4-dichlorophenyl)-3-prop-2-enyl-1,3-thiazol-3-ium-2-yl]amino]phenyl]acetamide (PubChem CID 3340964) has the molecular formula C20H18Cl2N3OS+ and a molecular weight of 419.36 g/mol. Its IUPAC name is N-[4-[[4-(2,4-dichlorophenyl)-3-prop-2-enyl-1,3-thiazol-3-ium-2-yl]amino]phenyl]acetamide.
| Compound Name | N-[4-[[4-(2,4-dichlorophenyl)-3-prop-2-enyl-1,3-thiazol-3-ium-2-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 3340964 |
| Molecular Formula | C20H18Cl2N3OS+ |
| Molecular Weight | 419.36 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | N-[4-[[4-(2,4-dichlorophenyl)-3-prop-2-enyl-1,3-thiazol-3-ium-2-yl]amino]phenyl]acetamide |
| SMILES | C=CC[n+]1c(-c2ccc(Cl)cc2Cl)csc1Nc1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C20H17Cl2N3OS/c1-3-10-25-19(17-9-4-14(21)11-18(17)22)12-27-20(25)24-16-7-5-15(6-8-16)23-13(2)26/h3-9,11-12H,1,10H2,2H3,(H,23,26)/p+1 |
| InChIKey | VLKKJRYAGFBBEU-UHFFFAOYSA-O |
| XLogP | 5.90 |
| TPSA | 45.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.36 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiaz_ene_D(8)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|