C18H15Cl2N — CID 54795871
2,4-dichloro-N-(2-naphthalen-1-ylethyl)aniline (PubChem CID 54795871) has the molecular formula C18H15Cl2N and a molecular weight of 316.23 g/mol. Its IUPAC name is 2,4-dichloro-N-(2-naphthalen-1-ylethyl)aniline.
| Compound Name | 2,4-dichloro-N-(2-naphthalen-1-ylethyl)aniline |
|---|---|
| PubChem CID | 54795871 |
| Molecular Formula | C18H15Cl2N |
| Molecular Weight | 316.23 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 2,4-dichloro-N-(2-naphthalen-1-ylethyl)aniline |
| SMILES | Clc1ccc(NCCc2cccc3ccccc23)c(Cl)c1 |
| InChI | InChI=1S/C18H15Cl2N/c19-15-8-9-18(17(20)12-15)21-11-10-14-6-3-5-13-4-1-2-7-16(13)14/h1-9,12,21H,10-11H2 |
| InChIKey | DOAVMEYFTBXWJC-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.23 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |