C19H17Cl3N2S — CID 45125414
4-(2,4-dichlorophenyl)-N-(3-methylphenyl)-3-prop-2-enyl-1,3-thiazol-3-ium-2-amine chloride (PubChem CID 45125414) has the molecular formula C19H17Cl3N2S and a molecular weight of 411.79 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-N-(3-methylphenyl)-3-prop-2-enyl-1,3-thiazol-3-ium-2-amine chloride.
| Compound Name | 4-(2,4-dichlorophenyl)-N-(3-methylphenyl)-3-prop-2-enyl-1,3-thiazol-3-ium-2-amine chloride |
|---|---|
| PubChem CID | 45125414 |
| Molecular Formula | C19H17Cl3N2S |
| Molecular Weight | 411.79 g/mol |
| Exact Mass | 410.02 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-N-(3-methylphenyl)-3-prop-2-enyl-1,3-thiazol-3-ium-2-amine chloride |
| SMILES | C=CC[n+]1c(-c2ccc(Cl)cc2Cl)csc1Nc1cccc(C)c1.[Cl-] |
| InChI | InChI=1S/C19H16Cl2N2S.ClH/c1-3-9-23-18(16-8-7-14(20)11-17(16)21)12-24-19(23)22-15-6-4-5-13(2)10-15;/h3-8,10-12H,1,9H2,2H3;1H |
| InChIKey | PVPRUANJKPYIAQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 15.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.79 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiaz_ene_D(8)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|