C24H23BrN2OS — CID 45125440
4-(4-methoxyphenyl)-N,3-bis(3-methylphenyl)-1,3-thiazol-3-ium-2-amine bromide (PubChem CID 45125440) has the molecular formula C24H23BrN2OS and a molecular weight of 467.43 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-N,3-bis(3-methylphenyl)-1,3-thiazol-3-ium-2-amine bromide.
| Compound Name | 4-(4-methoxyphenyl)-N,3-bis(3-methylphenyl)-1,3-thiazol-3-ium-2-amine bromide |
|---|---|
| PubChem CID | 45125440 |
| Molecular Formula | C24H23BrN2OS |
| Molecular Weight | 467.43 g/mol |
| Exact Mass | 466.07 |
| IUPAC Name | 4-(4-methoxyphenyl)-N,3-bis(3-methylphenyl)-1,3-thiazol-3-ium-2-amine bromide |
| SMILES | COc1ccc(-c2csc(Nc3cccc(C)c3)[n+]2-c2cccc(C)c2)cc1.[Br-] |
| InChI | InChI=1S/C24H22N2OS.BrH/c1-17-6-4-8-20(14-17)25-24-26(21-9-5-7-18(2)15-21)23(16-28-24)19-10-12-22(27-3)13-11-19;/h4-16H,1-3H3;1H |
| InChIKey | IKQATQHZRNOLHP-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 25.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.43 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiaz_ene_D(8)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|