C15H15Cl2NO — CID 54796172
N-[2-(2,4-dichlorophenoxy)ethyl]-3-methylaniline (PubChem CID 54796172) has the molecular formula C15H15Cl2NO and a molecular weight of 296.20 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenoxy)ethyl]-3-methylaniline.
| Compound Name | N-[2-(2,4-dichlorophenoxy)ethyl]-3-methylaniline |
|---|---|
| PubChem CID | 54796172 |
| Molecular Formula | C15H15Cl2NO |
| Molecular Weight | 296.20 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | N-[2-(2,4-dichlorophenoxy)ethyl]-3-methylaniline |
| SMILES | Cc1cccc(NCCOc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C15H15Cl2NO/c1-11-3-2-4-13(9-11)18-7-8-19-15-6-5-12(16)10-14(15)17/h2-6,9-10,18H,7-8H2,1H3 |
| InChIKey | YTFIXPNDJXUVNF-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.20 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|