C16H18ClNO — CID 55195520
3-chloro-N-[2-(2,3-dimethylphenoxy)ethyl]aniline (PubChem CID 55195520) has the molecular formula C16H18ClNO and a molecular weight of 275.78 g/mol. Its IUPAC name is 3-chloro-N-[2-(2,3-dimethylphenoxy)ethyl]aniline.
| Compound Name | 3-chloro-N-[2-(2,3-dimethylphenoxy)ethyl]aniline |
|---|---|
| PubChem CID | 55195520 |
| Molecular Formula | C16H18ClNO |
| Molecular Weight | 275.78 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 3-chloro-N-[2-(2,3-dimethylphenoxy)ethyl]aniline |
| SMILES | Cc1cccc(OCCNc2cccc(Cl)c2)c1C |
| InChI | InChI=1S/C16H18ClNO/c1-12-5-3-8-16(13(12)2)19-10-9-18-15-7-4-6-14(17)11-15/h3-8,11,18H,9-10H2,1-2H3 |
| InChIKey | KCAYQQBWPUELPH-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.78 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|