C19H16ClN — CID 115348592
N-(5-chloro-2,3-dihydro-1H-inden-2-yl)naphthalen-1-amine (PubChem CID 115348592) has the molecular formula C19H16ClN and a molecular weight of 293.80 g/mol. Its IUPAC name is N-(5-chloro-2,3-dihydro-1H-inden-2-yl)naphthalen-1-amine.
| Compound Name | N-(5-chloro-2,3-dihydro-1H-inden-2-yl)naphthalen-1-amine |
|---|---|
| PubChem CID | 115348592 |
| Molecular Formula | C19H16ClN |
| Molecular Weight | 293.80 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | N-(5-chloro-2,3-dihydro-1H-inden-2-yl)naphthalen-1-amine |
| SMILES | Clc1ccc2c(c1)CC(Nc1cccc3ccccc13)C2 |
| InChI | InChI=1S/C19H16ClN/c20-16-9-8-14-11-17(12-15(14)10-16)21-19-7-3-5-13-4-1-2-6-18(13)19/h1-10,17,21H,11-12H2 |
| InChIKey | ISJUDFZRWGTYHV-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.80 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |