C14H12ClFN2 — CID 116812769
N-(5-chloro-2,3-dihydro-1H-inden-2-yl)-6-fluoropyridin-2-amine (PubChem CID 116812769) has the molecular formula C14H12ClFN2 and a molecular weight of 262.72 g/mol. Its IUPAC name is N-(5-chloro-2,3-dihydro-1H-inden-2-yl)-6-fluoropyridin-2-amine.
| Compound Name | N-(5-chloro-2,3-dihydro-1H-inden-2-yl)-6-fluoropyridin-2-amine |
|---|---|
| PubChem CID | 116812769 |
| Molecular Formula | C14H12ClFN2 |
| Molecular Weight | 262.72 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | N-(5-chloro-2,3-dihydro-1H-inden-2-yl)-6-fluoropyridin-2-amine |
| SMILES | Fc1cccc(NC2Cc3ccc(Cl)cc3C2)n1 |
| InChI | InChI=1S/C14H12ClFN2/c15-11-5-4-9-7-12(8-10(9)6-11)17-14-3-1-2-13(16)18-14/h1-6,12H,7-8H2,(H,17,18) |
| InChIKey | JQLNGOLUOWBRLH-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.72 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|