C19H17N — CID 43512758
N-(2,3-dihydro-1H-inden-2-yl)naphthalen-1-amine (PubChem CID 43512758) has the molecular formula C19H17N and a molecular weight of 259.35 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-2-yl)naphthalen-1-amine.
| Compound Name | N-(2,3-dihydro-1H-inden-2-yl)naphthalen-1-amine |
|---|---|
| PubChem CID | 43512758 |
| Molecular Formula | C19H17N |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-2-yl)naphthalen-1-amine |
| SMILES | c1ccc2c(c1)CC(Nc1cccc3ccccc13)C2 |
| InChI | InChI=1S/C19H17N/c1-2-8-16-13-17(12-15(16)7-1)20-19-11-5-9-14-6-3-4-10-18(14)19/h1-11,17,20H,12-13H2 |
| InChIKey | WPMOTQQCOIMTLY-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |