C18H17N3 — CID 107844436
5-N-(2,3-dihydro-1H-inden-2-yl)quinoline-5,8-diamine (PubChem CID 107844436) has the molecular formula C18H17N3 and a molecular weight of 275.36 g/mol. Its IUPAC name is 5-N-(2,3-dihydro-1H-inden-2-yl)quinoline-5,8-diamine.
| Compound Name | 5-N-(2,3-dihydro-1H-inden-2-yl)quinoline-5,8-diamine |
|---|---|
| PubChem CID | 107844436 |
| Molecular Formula | C18H17N3 |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 5-N-(2,3-dihydro-1H-inden-2-yl)quinoline-5,8-diamine |
| SMILES | Nc1ccc(NC2Cc3ccccc3C2)c2cccnc12 |
| InChI | InChI=1S/C18H17N3/c19-16-7-8-17(15-6-3-9-20-18(15)16)21-14-10-12-4-1-2-5-13(12)11-14/h1-9,14,21H,10-11,19H2 |
| InChIKey | LHLNPDLLILMSEV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|