C16H22N4 — CID 83004330
5-N-(2,6-dimethylpiperidin-1-yl)quinoline-5,8-diamine (PubChem CID 83004330) has the molecular formula C16H22N4 and a molecular weight of 270.38 g/mol. Its IUPAC name is 5-N-(2,6-dimethylpiperidin-1-yl)quinoline-5,8-diamine.
| Compound Name | 5-N-(2,6-dimethylpiperidin-1-yl)quinoline-5,8-diamine |
|---|---|
| PubChem CID | 83004330 |
| Molecular Formula | C16H22N4 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 5-N-(2,6-dimethylpiperidin-1-yl)quinoline-5,8-diamine |
| SMILES | CC1CCCC(C)N1Nc1ccc(N)c2ncccc12 |
| InChI | InChI=1S/C16H22N4/c1-11-5-3-6-12(2)20(11)19-15-9-8-14(17)16-13(15)7-4-10-18-16/h4,7-12,19H,3,5-6,17H2,1-2H3 |
| InChIKey | CMDZBSRAORCHHO-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|