C13H16N4O — CID 83004132
5-N-morpholin-4-ylquinoline-5,8-diamine (PubChem CID 83004132) has the molecular formula C13H16N4O and a molecular weight of 244.30 g/mol. Its IUPAC name is 5-N-morpholin-4-ylquinoline-5,8-diamine.
| Compound Name | 5-N-morpholin-4-ylquinoline-5,8-diamine |
|---|---|
| PubChem CID | 83004132 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 5-N-morpholin-4-ylquinoline-5,8-diamine |
| SMILES | Nc1ccc(NN2CCOCC2)c2cccnc12 |
| InChI | InChI=1S/C13H16N4O/c14-11-3-4-12(10-2-1-5-15-13(10)11)16-17-6-8-18-9-7-17/h1-5,16H,6-9,14H2 |
| InChIKey | BXQMPDCIJLTRBW-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|