C15H19N3 — CID 113474938
5-N-(2-cyclopropylpropyl)quinoline-5,8-diamine (PubChem CID 113474938) has the molecular formula C15H19N3 and a molecular weight of 241.34 g/mol. Its IUPAC name is 5-N-(2-cyclopropylpropyl)quinoline-5,8-diamine.
| Compound Name | 5-N-(2-cyclopropylpropyl)quinoline-5,8-diamine |
|---|---|
| PubChem CID | 113474938 |
| Molecular Formula | C15H19N3 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 5-N-(2-cyclopropylpropyl)quinoline-5,8-diamine |
| SMILES | CC(CNc1ccc(N)c2ncccc12)C1CC1 |
| InChI | InChI=1S/C15H19N3/c1-10(11-4-5-11)9-18-14-7-6-13(16)15-12(14)3-2-8-17-15/h2-3,6-8,10-11,18H,4-5,9,16H2,1H3 |
| InChIKey | OHUVGSYYDPUYRS-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|