C16H23N3 — CID 83143113
4-N-(2,3,3-trimethylbutyl)quinoline-4,8-diamine (PubChem CID 83143113) has the molecular formula C16H23N3 and a molecular weight of 257.38 g/mol. Its IUPAC name is 4-N-(2,3,3-trimethylbutyl)quinoline-4,8-diamine.
| Compound Name | 4-N-(2,3,3-trimethylbutyl)quinoline-4,8-diamine |
|---|---|
| PubChem CID | 83143113 |
| Molecular Formula | C16H23N3 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | 4-N-(2,3,3-trimethylbutyl)quinoline-4,8-diamine |
| SMILES | CC(CNc1ccnc2c(N)cccc12)C(C)(C)C |
| InChI | InChI=1S/C16H23N3/c1-11(16(2,3)4)10-19-14-8-9-18-15-12(14)6-5-7-13(15)17/h5-9,11H,10,17H2,1-4H3,(H,18,19) |
| InChIKey | CCWGRRZIZADZNO-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|