C16H23N3 — CID 83060293
4-N-heptan-2-ylquinoline-4,8-diamine (PubChem CID 83060293) has the molecular formula C16H23N3 and a molecular weight of 257.38 g/mol. Its IUPAC name is 4-N-heptan-2-ylquinoline-4,8-diamine.
| Compound Name | 4-N-heptan-2-ylquinoline-4,8-diamine |
|---|---|
| PubChem CID | 83060293 |
| Molecular Formula | C16H23N3 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | 4-N-heptan-2-ylquinoline-4,8-diamine |
| SMILES | CCCCCC(C)Nc1ccnc2c(N)cccc12 |
| InChI | InChI=1S/C16H23N3/c1-3-4-5-7-12(2)19-15-10-11-18-16-13(15)8-6-9-14(16)17/h6,8-12H,3-5,7,17H2,1-2H3,(H,18,19) |
| InChIKey | ADZCLIUCLMWVRI-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|