C17H26N4 — CID 83065833
4-N-[1-(dimethylamino)-4-methylpentan-2-yl]quinoline-4,8-diamine (PubChem CID 83065833) has the molecular formula C17H26N4 and a molecular weight of 286.42 g/mol. Its IUPAC name is 4-N-[1-(dimethylamino)-4-methylpentan-2-yl]quinoline-4,8-diamine.
| Compound Name | 4-N-[1-(dimethylamino)-4-methylpentan-2-yl]quinoline-4,8-diamine |
|---|---|
| PubChem CID | 83065833 |
| Molecular Formula | C17H26N4 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.22 |
| IUPAC Name | 4-N-[1-(dimethylamino)-4-methylpentan-2-yl]quinoline-4,8-diamine |
| SMILES | CC(C)CC(CN(C)C)Nc1ccnc2c(N)cccc12 |
| InChI | InChI=1S/C17H26N4/c1-12(2)10-13(11-21(3)4)20-16-8-9-19-17-14(16)6-5-7-15(17)18/h5-9,12-13H,10-11,18H2,1-4H3,(H,19,20) |
| InChIKey | HENXNGQCLKNIPH-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|