C16H17N3S — CID 83061047
4-N-(1-thiophen-2-ylpropan-2-yl)quinoline-4,8-diamine (PubChem CID 83061047) has the molecular formula C16H17N3S and a molecular weight of 283.40 g/mol. Its IUPAC name is 4-N-(1-thiophen-2-ylpropan-2-yl)quinoline-4,8-diamine.
| Compound Name | 4-N-(1-thiophen-2-ylpropan-2-yl)quinoline-4,8-diamine |
|---|---|
| PubChem CID | 83061047 |
| Molecular Formula | C16H17N3S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 4-N-(1-thiophen-2-ylpropan-2-yl)quinoline-4,8-diamine |
| SMILES | CC(Cc1cccs1)Nc1ccnc2c(N)cccc12 |
| InChI | InChI=1S/C16H17N3S/c1-11(10-12-4-3-9-20-12)19-15-7-8-18-16-13(15)5-2-6-14(16)17/h2-9,11H,10,17H2,1H3,(H,18,19) |
| InChIKey | QSCNMNVEPQEVKK-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|