C17H23N3 — CID 63243660
5-N-[(4-methylcyclohexyl)methyl]quinoline-5,8-diamine (PubChem CID 63243660) has the molecular formula C17H23N3 and a molecular weight of 269.39 g/mol. Its IUPAC name is 5-N-[(4-methylcyclohexyl)methyl]quinoline-5,8-diamine.
| Compound Name | 5-N-[(4-methylcyclohexyl)methyl]quinoline-5,8-diamine |
|---|---|
| PubChem CID | 63243660 |
| Molecular Formula | C17H23N3 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | 5-N-[(4-methylcyclohexyl)methyl]quinoline-5,8-diamine |
| SMILES | CC1CCC(CNc2ccc(N)c3ncccc23)CC1 |
| InChI | InChI=1S/C17H23N3/c1-12-4-6-13(7-5-12)11-20-16-9-8-15(18)17-14(16)3-2-10-19-17/h2-3,8-10,12-13,20H,4-7,11,18H2,1H3 |
| InChIKey | XZFZGBCMHWURDT-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|