C25H23BrN4S — CID 45125447
4-(4-methylphenyl)-N-(4-phenyldiazenylphenyl)-3-prop-2-enyl-1,3-thiazol-3-ium-2-amine bromide (PubChem CID 45125447) has the molecular formula C25H23BrN4S and a molecular weight of 491.46 g/mol. Its IUPAC name is 4-(4-methylphenyl)-N-(4-phenyldiazenylphenyl)-3-prop-2-enyl-1,3-thiazol-3-ium-2-amine bromide.
| Compound Name | 4-(4-methylphenyl)-N-(4-phenyldiazenylphenyl)-3-prop-2-enyl-1,3-thiazol-3-ium-2-amine bromide |
|---|---|
| PubChem CID | 45125447 |
| Molecular Formula | C25H23BrN4S |
| Molecular Weight | 491.46 g/mol |
| Exact Mass | 490.08 |
| IUPAC Name | 4-(4-methylphenyl)-N-(4-phenyldiazenylphenyl)-3-prop-2-enyl-1,3-thiazol-3-ium-2-amine bromide |
| SMILES | C=CC[n+]1c(-c2ccc(C)cc2)csc1Nc1ccc(/N=N/c2ccccc2)cc1.[Br-] |
| InChI | InChI=1S/C25H22N4S.BrH/c1-3-17-29-24(20-11-9-19(2)10-12-20)18-30-25(29)26-21-13-15-23(16-14-21)28-27-22-7-5-4-6-8-22;/h3-16,18H,1,17H2,2H3;1H/b28-27+; |
| InChIKey | WJRHSQKTPIDRLX-RXQWRGDBSA-N |
| XLogP | 4.36 |
| TPSA | 40.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.46 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'thiaz_ene_D(8)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|