C25H23N2OS+ — CID 126574994
1-[4-[[3-benzyl-4-(4-methylphenyl)-1,3-thiazol-3-ium-2-yl]amino]phenyl]ethanone (PubChem CID 126574994) has the molecular formula C25H23N2OS+ and a molecular weight of 399.54 g/mol. Its IUPAC name is 1-[4-[[3-benzyl-4-(4-methylphenyl)-1,3-thiazol-3-ium-2-yl]amino]phenyl]ethanone.
| Compound Name | 1-[4-[[3-benzyl-4-(4-methylphenyl)-1,3-thiazol-3-ium-2-yl]amino]phenyl]ethanone |
|---|---|
| PubChem CID | 126574994 |
| Molecular Formula | C25H23N2OS+ |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 1-[4-[[3-benzyl-4-(4-methylphenyl)-1,3-thiazol-3-ium-2-yl]amino]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(Nc2scc(-c3ccc(C)cc3)[n+]2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C25H22N2OS/c1-18-8-10-22(11-9-18)24-17-29-25(27(24)16-20-6-4-3-5-7-20)26-23-14-12-21(13-15-23)19(2)28/h3-15,17H,16H2,1-2H3/p+1 |
| InChIKey | KDNIDLDLJJIXOH-UHFFFAOYSA-O |
| XLogP | 6.01 |
| TPSA | 32.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiaz_ene_D(8)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|