C33H28BrNOS — CID 135051570
2-(1-benzyl-4,6-diphenylpyridin-1-ium-2-yl)sulfanyl-1-(4-methylphenyl)ethanone bromide (PubChem CID 135051570) has the molecular formula C33H28BrNOS and a molecular weight of 566.56 g/mol. Its IUPAC name is 2-(1-benzyl-4,6-diphenylpyridin-1-ium-2-yl)sulfanyl-1-(4-methylphenyl)ethanone bromide.
| Compound Name | 2-(1-benzyl-4,6-diphenylpyridin-1-ium-2-yl)sulfanyl-1-(4-methylphenyl)ethanone bromide |
|---|---|
| PubChem CID | 135051570 |
| Molecular Formula | C33H28BrNOS |
| Molecular Weight | 566.56 g/mol |
| Exact Mass | 565.11 |
| IUPAC Name | 2-(1-benzyl-4,6-diphenylpyridin-1-ium-2-yl)sulfanyl-1-(4-methylphenyl)ethanone bromide |
| SMILES | Cc1ccc(C(=O)CSc2cc(-c3ccccc3)cc(-c3ccccc3)[n+]2Cc2ccccc2)cc1.[Br-] |
| InChI | InChI=1S/C33H28NOS.BrH/c1-25-17-19-29(20-18-25)32(35)24-36-33-22-30(27-13-7-3-8-14-27)21-31(28-15-9-4-10-16-28)34(33)23-26-11-5-2-6-12-26;/h2-22H,23-24H2,1H3;1H/q+1;/p-1 |
| InChIKey | ABBHWOXXDOGCII-UHFFFAOYSA-M |
| XLogP | 4.64 |
| TPSA | 20.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.56 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|