C22H23BrNO+ — CID 126959018
1-(4-phenylphenyl)-2-(2,4,6-trimethylpyridin-1-ium-1-yl)ethanone;hydrobromide (PubChem CID 126959018) has the molecular formula C22H23BrNO+ and a molecular weight of 397.34 g/mol. Its IUPAC name is 1-(4-phenylphenyl)-2-(2,4,6-trimethylpyridin-1-ium-1-yl)ethanone;hydrobromide.
| Compound Name | 1-(4-phenylphenyl)-2-(2,4,6-trimethylpyridin-1-ium-1-yl)ethanone;hydrobromide |
|---|---|
| PubChem CID | 126959018 |
| Molecular Formula | C22H23BrNO+ |
| Molecular Weight | 397.34 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | 1-(4-phenylphenyl)-2-(2,4,6-trimethylpyridin-1-ium-1-yl)ethanone;hydrobromide |
| SMILES | Br.Cc1cc(C)[n+](CC(=O)c2ccc(-c3ccccc3)cc2)c(C)c1 |
| InChI | InChI=1S/C22H22NO.BrH/c1-16-13-17(2)23(18(3)14-16)15-22(24)21-11-9-20(10-12-21)19-7-5-4-6-8-19;/h4-14H,15H2,1-3H3;1H/q+1; |
| InChIKey | XPMYQIZZIGZAES-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 20.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.34 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|