C14H16NOS+ — CID 13212730
2-(2,4-dimethyl-1,3-thiazol-3-ium-3-yl)-1-(4-methylphenyl)ethanone (PubChem CID 13212730) has the molecular formula C14H16NOS+ and a molecular weight of 246.36 g/mol. Its IUPAC name is 2-(2,4-dimethyl-1,3-thiazol-3-ium-3-yl)-1-(4-methylphenyl)ethanone.
| Compound Name | 2-(2,4-dimethyl-1,3-thiazol-3-ium-3-yl)-1-(4-methylphenyl)ethanone |
|---|---|
| PubChem CID | 13212730 |
| Molecular Formula | C14H16NOS+ |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 2-(2,4-dimethyl-1,3-thiazol-3-ium-3-yl)-1-(4-methylphenyl)ethanone |
| SMILES | Cc1ccc(C(=O)C[n+]2c(C)csc2C)cc1 |
| InChI | InChI=1S/C14H16NOS/c1-10-4-6-13(7-5-10)14(16)8-15-11(2)9-17-12(15)3/h4-7,9H,8H2,1-3H3/q+1 |
| InChIKey | BRXAENYJTXXLBC-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 20.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|