C16H19BrN2O2 — CID 10926182
2-(2-amino-4,5,6,7-tetrahydro-1,3-benzoxazol-3-ium-3-yl)-1-(4-methylphenyl)ethanone bromide (PubChem CID 10926182) has the molecular formula C16H19BrN2O2 and a molecular weight of 351.24 g/mol. Its IUPAC name is 2-(2-amino-4,5,6,7-tetrahydro-1,3-benzoxazol-3-ium-3-yl)-1-(4-methylphenyl)ethanone bromide.
| Compound Name | 2-(2-amino-4,5,6,7-tetrahydro-1,3-benzoxazol-3-ium-3-yl)-1-(4-methylphenyl)ethanone bromide |
|---|---|
| PubChem CID | 10926182 |
| Molecular Formula | C16H19BrN2O2 |
| Molecular Weight | 351.24 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | 2-(2-amino-4,5,6,7-tetrahydro-1,3-benzoxazol-3-ium-3-yl)-1-(4-methylphenyl)ethanone bromide |
| SMILES | Cc1ccc(C(=O)C[n+]2c(N)oc3c2CCCC3)cc1.[Br-] |
| InChI | InChI=1S/C16H18N2O2.BrH/c1-11-6-8-12(9-7-11)14(19)10-18-13-4-2-3-5-15(13)20-16(18)17;/h6-9,17H,2-5,10H2,1H3;1H |
| InChIKey | CJJBDPFZLANDKS-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 60.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.24 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|