C11H11Br2N3O2 — CID 13120609
2-(2-amino-5-methyl-1,3,4-oxadiazol-3-ium-3-yl)-1-(4-bromophenyl)ethanone bromide (PubChem CID 13120609) has the molecular formula C11H11Br2N3O2 and a molecular weight of 377.04 g/mol. Its IUPAC name is 2-(2-amino-5-methyl-1,3,4-oxadiazol-3-ium-3-yl)-1-(4-bromophenyl)ethanone bromide.
| Compound Name | 2-(2-amino-5-methyl-1,3,4-oxadiazol-3-ium-3-yl)-1-(4-bromophenyl)ethanone bromide |
|---|---|
| PubChem CID | 13120609 |
| Molecular Formula | C11H11Br2N3O2 |
| Molecular Weight | 377.04 g/mol |
| Exact Mass | 374.92 |
| IUPAC Name | 2-(2-amino-5-methyl-1,3,4-oxadiazol-3-ium-3-yl)-1-(4-bromophenyl)ethanone bromide |
| SMILES | Cc1n[n+](CC(=O)c2ccc(Br)cc2)c(N)o1.[Br-] |
| InChI | InChI=1S/C11H10BrN3O2.BrH/c1-7-14-15(11(13)17-7)6-10(16)8-2-4-9(12)5-3-8;/h2-5,13H,6H2,1H3;1H |
| InChIKey | XCBWMSIUZRPYIJ-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 73.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.04 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|