C13H13BrNOS+ — CID 2267287
1-(4-bromophenyl)-2-(4,5-dimethyl-1,3-thiazol-3-ium-3-yl)ethanone (PubChem CID 2267287) has the molecular formula C13H13BrNOS+ and a molecular weight of 311.22 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2-(4,5-dimethyl-1,3-thiazol-3-ium-3-yl)ethanone.
| Compound Name | 1-(4-bromophenyl)-2-(4,5-dimethyl-1,3-thiazol-3-ium-3-yl)ethanone |
|---|---|
| PubChem CID | 2267287 |
| Molecular Formula | C13H13BrNOS+ |
| Molecular Weight | 311.22 g/mol |
| Exact Mass | 309.99 |
| IUPAC Name | 1-(4-bromophenyl)-2-(4,5-dimethyl-1,3-thiazol-3-ium-3-yl)ethanone |
| SMILES | Cc1sc[n+](CC(=O)c2ccc(Br)cc2)c1C |
| InChI | InChI=1S/C13H13BrNOS/c1-9-10(2)17-8-15(9)7-13(16)11-3-5-12(14)6-4-11/h3-6,8H,7H2,1-2H3/q+1 |
| InChIKey | MNXFAHBZZGEGPQ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 20.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.22 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|