C14H15ClNO2S+ — CID 18432197
1-(4-chlorophenyl)-2-[5-(2-hydroxyethyl)-4-methyl-1,3-thiazol-3-ium-3-yl]ethanone (PubChem CID 18432197) has the molecular formula C14H15ClNO2S+ and a molecular weight of 296.80 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-[5-(2-hydroxyethyl)-4-methyl-1,3-thiazol-3-ium-3-yl]ethanone.
| Compound Name | 1-(4-chlorophenyl)-2-[5-(2-hydroxyethyl)-4-methyl-1,3-thiazol-3-ium-3-yl]ethanone |
|---|---|
| PubChem CID | 18432197 |
| Molecular Formula | C14H15ClNO2S+ |
| Molecular Weight | 296.80 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 1-(4-chlorophenyl)-2-[5-(2-hydroxyethyl)-4-methyl-1,3-thiazol-3-ium-3-yl]ethanone |
| SMILES | Cc1c(CCO)sc[n+]1CC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H15ClNO2S/c1-10-14(6-7-17)19-9-16(10)8-13(18)11-2-4-12(15)5-3-11/h2-5,9,17H,6-8H2,1H3/q+1 |
| InChIKey | UEMMLWQTIDSRIF-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 41.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.80 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|