C22H21BrNO+ — CID 12528659
2-(4-benzyl-2,5-dimethylpyridin-1-ium-1-yl)-1-(4-bromophenyl)ethanone (PubChem CID 12528659) has the molecular formula C22H21BrNO+ and a molecular weight of 395.32 g/mol. Its IUPAC name is 2-(4-benzyl-2,5-dimethylpyridin-1-ium-1-yl)-1-(4-bromophenyl)ethanone.
| Compound Name | 2-(4-benzyl-2,5-dimethylpyridin-1-ium-1-yl)-1-(4-bromophenyl)ethanone |
|---|---|
| PubChem CID | 12528659 |
| Molecular Formula | C22H21BrNO+ |
| Molecular Weight | 395.32 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 2-(4-benzyl-2,5-dimethylpyridin-1-ium-1-yl)-1-(4-bromophenyl)ethanone |
| SMILES | Cc1c[n+](CC(=O)c2ccc(Br)cc2)c(C)cc1Cc1ccccc1 |
| InChI | InChI=1S/C22H21BrNO/c1-16-14-24(15-22(25)19-8-10-21(23)11-9-19)17(2)12-20(16)13-18-6-4-3-5-7-18/h3-12,14H,13,15H2,1-2H3/q+1 |
| InChIKey | NIRYAAGJUDIAHB-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 20.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.32 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|