C18H16Br2N3O+ — CID 4209454
2-[2-amino-4-(4-bromophenyl)-3-methylimidazol-1-ium-1-yl]-1-(4-bromophenyl)ethanone (PubChem CID 4209454) has the molecular formula C18H16Br2N3O+ and a molecular weight of 450.15 g/mol. Its IUPAC name is 2-[2-amino-4-(4-bromophenyl)-3-methylimidazol-1-ium-1-yl]-1-(4-bromophenyl)ethanone.
| Compound Name | 2-[2-amino-4-(4-bromophenyl)-3-methylimidazol-1-ium-1-yl]-1-(4-bromophenyl)ethanone |
|---|---|
| PubChem CID | 4209454 |
| Molecular Formula | C18H16Br2N3O+ |
| Molecular Weight | 450.15 g/mol |
| Exact Mass | 447.97 |
| IUPAC Name | 2-[2-amino-4-(4-bromophenyl)-3-methylimidazol-1-ium-1-yl]-1-(4-bromophenyl)ethanone |
| SMILES | Cn1c(-c2ccc(Br)cc2)c[n+](CC(=O)c2ccc(Br)cc2)c1N |
| InChI | InChI=1S/C18H15Br2N3O/c1-22-16(12-2-6-14(19)7-3-12)10-23(18(22)21)11-17(24)13-4-8-15(20)9-5-13/h2-10,21H,11H2,1H3/p+1 |
| InChIKey | GDBBTJNBVNUBNN-UHFFFAOYSA-O |
| XLogP | 3.97 |
| TPSA | 51.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.15 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|