C24H20Cl2N3O+ — CID 3604583
2-[2-amino-3-methyl-4-(4-phenylphenyl)imidazol-1-ium-1-yl]-1-(3,4-dichlorophenyl)ethanone (PubChem CID 3604583) has the molecular formula C24H20Cl2N3O+ and a molecular weight of 437.35 g/mol. Its IUPAC name is 2-[2-amino-3-methyl-4-(4-phenylphenyl)imidazol-1-ium-1-yl]-1-(3,4-dichlorophenyl)ethanone.
| Compound Name | 2-[2-amino-3-methyl-4-(4-phenylphenyl)imidazol-1-ium-1-yl]-1-(3,4-dichlorophenyl)ethanone |
|---|---|
| PubChem CID | 3604583 |
| Molecular Formula | C24H20Cl2N3O+ |
| Molecular Weight | 437.35 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 2-[2-amino-3-methyl-4-(4-phenylphenyl)imidazol-1-ium-1-yl]-1-(3,4-dichlorophenyl)ethanone |
| SMILES | Cn1c(-c2ccc(-c3ccccc3)cc2)c[n+](CC(=O)c2ccc(Cl)c(Cl)c2)c1N |
| InChI | InChI=1S/C24H19Cl2N3O/c1-28-22(18-9-7-17(8-10-18)16-5-3-2-4-6-16)14-29(24(28)27)15-23(30)19-11-12-20(25)21(26)13-19/h2-14,27H,15H2,1H3/p+1 |
| InChIKey | TXDHMULPTPUGDK-UHFFFAOYSA-O |
| XLogP | 5.42 |
| TPSA | 51.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.35 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|