C18H15Cl3N3O+ — CID 4280283
2-[2-amino-4-(3-chlorophenyl)-3-methylimidazol-1-ium-1-yl]-1-(3,4-dichlorophenyl)ethanone (PubChem CID 4280283) has the molecular formula C18H15Cl3N3O+ and a molecular weight of 395.70 g/mol. Its IUPAC name is 2-[2-amino-4-(3-chlorophenyl)-3-methylimidazol-1-ium-1-yl]-1-(3,4-dichlorophenyl)ethanone.
| Compound Name | 2-[2-amino-4-(3-chlorophenyl)-3-methylimidazol-1-ium-1-yl]-1-(3,4-dichlorophenyl)ethanone |
|---|---|
| PubChem CID | 4280283 |
| Molecular Formula | C18H15Cl3N3O+ |
| Molecular Weight | 395.70 g/mol |
| Exact Mass | 394.03 |
| IUPAC Name | 2-[2-amino-4-(3-chlorophenyl)-3-methylimidazol-1-ium-1-yl]-1-(3,4-dichlorophenyl)ethanone |
| SMILES | Cn1c(-c2cccc(Cl)c2)c[n+](CC(=O)c2ccc(Cl)c(Cl)c2)c1N |
| InChI | InChI=1S/C18H14Cl3N3O/c1-23-16(11-3-2-4-13(19)7-11)9-24(18(23)22)10-17(25)12-5-6-14(20)15(21)8-12/h2-9,22H,10H2,1H3/p+1 |
| InChIKey | KCOKOJUHCDEECG-UHFFFAOYSA-O |
| XLogP | 4.40 |
| TPSA | 51.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.70 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|