C30H26N3O+ — CID 4242965
2-[2-amino-3-methyl-4-(4-phenylphenyl)imidazol-1-ium-1-yl]-1-(4-phenylphenyl)ethanone (PubChem CID 4242965) has the molecular formula C30H26N3O+ and a molecular weight of 444.56 g/mol. Its IUPAC name is 2-[2-amino-3-methyl-4-(4-phenylphenyl)imidazol-1-ium-1-yl]-1-(4-phenylphenyl)ethanone.
| Compound Name | 2-[2-amino-3-methyl-4-(4-phenylphenyl)imidazol-1-ium-1-yl]-1-(4-phenylphenyl)ethanone |
|---|---|
| PubChem CID | 4242965 |
| Molecular Formula | C30H26N3O+ |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | 2-[2-amino-3-methyl-4-(4-phenylphenyl)imidazol-1-ium-1-yl]-1-(4-phenylphenyl)ethanone |
| SMILES | Cn1c(-c2ccc(-c3ccccc3)cc2)c[n+](CC(=O)c2ccc(-c3ccccc3)cc2)c1N |
| InChI | InChI=1S/C30H25N3O/c1-32-28(26-16-12-24(13-17-26)22-8-4-2-5-9-22)20-33(30(32)31)21-29(34)27-18-14-25(15-19-27)23-10-6-3-7-11-23/h2-20,31H,21H2,1H3/p+1 |
| InChIKey | ODMKYDALPCAZRG-UHFFFAOYSA-O |
| XLogP | 5.78 |
| TPSA | 51.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|