C24H21Br2N3O — CID 163327645
2-[2-amino-3-methyl-4-(4-phenylphenyl)imidazol-1-ium-1-yl]-1-(3-bromophenyl)ethanone bromide (PubChem CID 163327645) has the molecular formula C24H21Br2N3O and a molecular weight of 527.26 g/mol. Its IUPAC name is 2-[2-amino-3-methyl-4-(4-phenylphenyl)imidazol-1-ium-1-yl]-1-(3-bromophenyl)ethanone bromide.
| Compound Name | 2-[2-amino-3-methyl-4-(4-phenylphenyl)imidazol-1-ium-1-yl]-1-(3-bromophenyl)ethanone bromide |
|---|---|
| PubChem CID | 163327645 |
| Molecular Formula | C24H21Br2N3O |
| Molecular Weight | 527.26 g/mol |
| Exact Mass | 525.01 |
| IUPAC Name | 2-[2-amino-3-methyl-4-(4-phenylphenyl)imidazol-1-ium-1-yl]-1-(3-bromophenyl)ethanone bromide |
| SMILES | Cn1c(-c2ccc(-c3ccccc3)cc2)c[n+](CC(=O)c2cccc(Br)c2)c1N.[Br-] |
| InChI | InChI=1S/C24H20BrN3O.BrH/c1-27-22(19-12-10-18(11-13-19)17-6-3-2-4-7-17)15-28(24(27)26)16-23(29)20-8-5-9-21(25)14-20;/h2-15,26H,16H2,1H3;1H |
| InChIKey | QJCZNNUJEABXLB-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 51.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.26 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|