C19H19BrN3O2+ — CID 4535939
2-[2-amino-4-(3-bromophenyl)-3-methylimidazol-1-ium-1-yl]-1-(4-methoxyphenyl)ethanone (PubChem CID 4535939) has the molecular formula C19H19BrN3O2+ and a molecular weight of 401.28 g/mol. Its IUPAC name is 2-[2-amino-4-(3-bromophenyl)-3-methylimidazol-1-ium-1-yl]-1-(4-methoxyphenyl)ethanone.
| Compound Name | 2-[2-amino-4-(3-bromophenyl)-3-methylimidazol-1-ium-1-yl]-1-(4-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 4535939 |
| Molecular Formula | C19H19BrN3O2+ |
| Molecular Weight | 401.28 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | 2-[2-amino-4-(3-bromophenyl)-3-methylimidazol-1-ium-1-yl]-1-(4-methoxyphenyl)ethanone |
| SMILES | COc1ccc(C(=O)C[n+]2cc(-c3cccc(Br)c3)n(C)c2N)cc1 |
| InChI | InChI=1S/C19H18BrN3O2/c1-22-17(14-4-3-5-15(20)10-14)11-23(19(22)21)12-18(24)13-6-8-16(25-2)9-7-13/h3-11,21H,12H2,1-2H3/p+1 |
| InChIKey | OZBIFWVQFNQFCI-UHFFFAOYSA-O |
| XLogP | 3.22 |
| TPSA | 61.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.28 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|