C19H19BrClN3O2 — CID 163327689
2-[2-amino-4-(4-methoxyphenyl)-3-methylimidazol-1-ium-1-yl]-1-(4-chlorophenyl)ethanone bromide (PubChem CID 163327689) has the molecular formula C19H19BrClN3O2 and a molecular weight of 436.74 g/mol. Its IUPAC name is 2-[2-amino-4-(4-methoxyphenyl)-3-methylimidazol-1-ium-1-yl]-1-(4-chlorophenyl)ethanone bromide.
| Compound Name | 2-[2-amino-4-(4-methoxyphenyl)-3-methylimidazol-1-ium-1-yl]-1-(4-chlorophenyl)ethanone bromide |
|---|---|
| PubChem CID | 163327689 |
| Molecular Formula | C19H19BrClN3O2 |
| Molecular Weight | 436.74 g/mol |
| Exact Mass | 435.03 |
| IUPAC Name | 2-[2-amino-4-(4-methoxyphenyl)-3-methylimidazol-1-ium-1-yl]-1-(4-chlorophenyl)ethanone bromide |
| SMILES | COc1ccc(-c2c[n+](CC(=O)c3ccc(Cl)cc3)c(N)n2C)cc1.[Br-] |
| InChI | InChI=1S/C19H18ClN3O2.BrH/c1-22-17(13-5-9-16(25-2)10-6-13)11-23(19(22)21)12-18(24)14-3-7-15(20)8-4-14;/h3-11,21H,12H2,1-2H3;1H |
| InChIKey | BGMDHIHSIMXXKD-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 61.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.74 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|