C22H22BrClN2O2 — CID 56726113
1-(4-chlorophenyl)-2-[3-(4-ethoxyphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]ethanone bromide (PubChem CID 56726113) has the molecular formula C22H22BrClN2O2 and a molecular weight of 461.79 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-[3-(4-ethoxyphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]ethanone bromide.
| Compound Name | 1-(4-chlorophenyl)-2-[3-(4-ethoxyphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]ethanone bromide |
|---|---|
| PubChem CID | 56726113 |
| Molecular Formula | C22H22BrClN2O2 |
| Molecular Weight | 461.79 g/mol |
| Exact Mass | 460.06 |
| IUPAC Name | 1-(4-chlorophenyl)-2-[3-(4-ethoxyphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]ethanone bromide |
| SMILES | CCOc1ccc(-c2c[n+](CC(=O)c3ccc(Cl)cc3)c3n2CCC3)cc1.[Br-] |
| InChI | InChI=1S/C22H22ClN2O2.BrH/c1-2-27-19-11-7-16(8-12-19)20-14-24(22-4-3-13-25(20)22)15-21(26)17-5-9-18(23)10-6-17;/h5-12,14H,2-4,13,15H2,1H3;1H/q+1;/p-1 |
| InChIKey | DFFJYNBQKZTBHZ-UHFFFAOYSA-M |
| XLogP | 1.33 |
| TPSA | 35.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.79 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|