C24H20BrClN2O — CID 44665841
2-[3-(4-chlorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]-1-naphthalen-1-ylethanone bromide (PubChem CID 44665841) has the molecular formula C24H20BrClN2O and a molecular weight of 467.79 g/mol. Its IUPAC name is 2-[3-(4-chlorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]-1-naphthalen-1-ylethanone bromide.
| Compound Name | 2-[3-(4-chlorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]-1-naphthalen-1-ylethanone bromide |
|---|---|
| PubChem CID | 44665841 |
| Molecular Formula | C24H20BrClN2O |
| Molecular Weight | 467.79 g/mol |
| Exact Mass | 466.04 |
| IUPAC Name | 2-[3-(4-chlorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]-1-naphthalen-1-ylethanone bromide |
| SMILES | O=C(C[n+]1cc(-c2ccc(Cl)cc2)n2c1CCC2)c1cccc2ccccc12.[Br-] |
| InChI | InChI=1S/C24H20ClN2O.BrH/c25-19-12-10-18(11-13-19)22-15-26(24-9-4-14-27(22)24)16-23(28)21-8-3-6-17-5-1-2-7-20(17)21;/h1-3,5-8,10-13,15H,4,9,14,16H2;1H/q+1;/p-1 |
| InChIKey | FCFOEEZGPXAJPZ-UHFFFAOYSA-M |
| XLogP | 2.08 |
| TPSA | 25.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.79 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|