C18H23BrN2O — CID 44664140
3,3-dimethyl-1-(3-phenyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl)butan-2-one bromide (PubChem CID 44664140) has the molecular formula C18H23BrN2O and a molecular weight of 363.30 g/mol. Its IUPAC name is 3,3-dimethyl-1-(3-phenyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl)butan-2-one bromide.
| Compound Name | 3,3-dimethyl-1-(3-phenyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl)butan-2-one bromide |
|---|---|
| PubChem CID | 44664140 |
| Molecular Formula | C18H23BrN2O |
| Molecular Weight | 363.30 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 3,3-dimethyl-1-(3-phenyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl)butan-2-one bromide |
| SMILES | CC(C)(C)C(=O)C[n+]1cc(-c2ccccc2)n2c1CCC2.[Br-] |
| InChI | InChI=1S/C18H23N2O.BrH/c1-18(2,3)16(21)13-19-12-15(14-8-5-4-6-9-14)20-11-7-10-17(19)20;/h4-6,8-9,12H,7,10-11,13H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | DELFXLFTIXRLMT-UHFFFAOYSA-M |
| XLogP | 0.01 |
| TPSA | 25.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.30 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|