C23H25N2O+ — CID 2027063
2-(3-phenyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl)-1-(4-propan-2-ylphenyl)ethanone (PubChem CID 2027063) has the molecular formula C23H25N2O+ and a molecular weight of 345.47 g/mol. Its IUPAC name is 2-(3-phenyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl)-1-(4-propan-2-ylphenyl)ethanone.
| Compound Name | 2-(3-phenyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl)-1-(4-propan-2-ylphenyl)ethanone |
|---|---|
| PubChem CID | 2027063 |
| Molecular Formula | C23H25N2O+ |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.20 |
| IUPAC Name | 2-(3-phenyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl)-1-(4-propan-2-ylphenyl)ethanone |
| SMILES | CC(C)c1ccc(C(=O)C[n+]2cc(-c3ccccc3)n3c2CCC3)cc1 |
| InChI | InChI=1S/C23H25N2O/c1-17(2)18-10-12-20(13-11-18)22(26)16-24-15-21(19-7-4-3-5-8-19)25-14-6-9-23(24)25/h3-5,7-8,10-13,15,17H,6,9,14,16H2,1-2H3/q+1 |
| InChIKey | JQSVCVYWJSWBHL-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 25.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|