C20H20ClN3O — CID 44662805
N-phenyl-2-(3-phenyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl)acetamide chloride (PubChem CID 44662805) has the molecular formula C20H20ClN3O and a molecular weight of 353.85 g/mol. Its IUPAC name is N-phenyl-2-(3-phenyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl)acetamide chloride.
| Compound Name | N-phenyl-2-(3-phenyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl)acetamide chloride |
|---|---|
| PubChem CID | 44662805 |
| Molecular Formula | C20H20ClN3O |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | N-phenyl-2-(3-phenyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl)acetamide chloride |
| SMILES | O=C(C[n+]1cc(-c2ccccc2)n2c1CCC2)Nc1ccccc1.[Cl-] |
| InChI | InChI=1S/C20H19N3O.ClH/c24-19(21-17-10-5-2-6-11-17)15-22-14-18(16-8-3-1-4-9-16)23-13-7-12-20(22)23;/h1-6,8-11,14H,7,12-13,15H2;1H |
| InChIKey | MEFIWKXPFOFYRN-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|